C16H21FN2O2S — CID 97077772
1-[(R)-cyclopropyl-(4-fluorophenyl)methyl]-3-[[(3S)-3-hydroxythiolan-3-yl]methyl]urea (PubChem CID 97077772) has the molecular formula C16H21FN2O2S and a molecular weight of 324.42 g/mol. Its IUPAC name is 1-[(R)-cyclopropyl-(4-fluorophenyl)methyl]-3-[[(3S)-3-hydroxythiolan-3-yl]methyl]urea.
| Compound Name | 1-[(R)-cyclopropyl-(4-fluorophenyl)methyl]-3-[[(3S)-3-hydroxythiolan-3-yl]methyl]urea |
|---|---|
| PubChem CID | 97077772 |
| Molecular Formula | C16H21FN2O2S |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 1-[(R)-cyclopropyl-(4-fluorophenyl)methyl]-3-[[(3S)-3-hydroxythiolan-3-yl]methyl]urea |
| SMILES | O=C(NC[C@@]1(O)CCSC1)N[C@@H](c1ccc(F)cc1)C1CC1 |
| InChI | InChI=1S/C16H21FN2O2S/c17-13-5-3-12(4-6-13)14(11-1-2-11)19-15(20)18-9-16(21)7-8-22-10-16/h3-6,11,14,21H,1-2,7-10H2,(H2,18,19,20)/t14-,16+/m1/s1 |
| InChIKey | AQDSSDUIXLHCPH-ZBFHGGJFSA-N |
| XLogP | 2.44 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |