C17H24BrN3O — CID 97078137
N-(4-bromophenyl)-2-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]acetamide (PubChem CID 97078137) has the molecular formula C17H24BrN3O and a molecular weight of 366.30 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]acetamide.
| Compound Name | N-(4-bromophenyl)-2-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 97078137 |
| Molecular Formula | C17H24BrN3O |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | N-(4-bromophenyl)-2-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]acetamide |
| SMILES | O=C(CN1CCC[C@H]1CN1CCCC1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H24BrN3O/c18-14-5-7-15(8-6-14)19-17(22)13-21-11-3-4-16(21)12-20-9-1-2-10-20/h5-8,16H,1-4,9-13H2,(H,19,22)/t16-/m0/s1 |
| InChIKey | ZCVFHHJGKKEWKG-INIZCTEOSA-N |
| XLogP | 2.95 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |