C14H20FNO2 — CID 97078263
3-(3-fluorophenyl)-N-[(2S)-2-hydroxy-3-methylbutyl]propanamide (PubChem CID 97078263) has the molecular formula C14H20FNO2 and a molecular weight of 253.32 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-N-[(2S)-2-hydroxy-3-methylbutyl]propanamide.
| Compound Name | 3-(3-fluorophenyl)-N-[(2S)-2-hydroxy-3-methylbutyl]propanamide |
|---|---|
| PubChem CID | 97078263 |
| Molecular Formula | C14H20FNO2 |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 3-(3-fluorophenyl)-N-[(2S)-2-hydroxy-3-methylbutyl]propanamide |
| SMILES | CC(C)[C@H](O)CNC(=O)CCc1cccc(F)c1 |
| InChI | InChI=1S/C14H20FNO2/c1-10(2)13(17)9-16-14(18)7-6-11-4-3-5-12(15)8-11/h3-5,8,10,13,17H,6-7,9H2,1-2H3,(H,16,18)/t13-/m1/s1 |
| InChIKey | RBASMHRSAZIWLV-CYBMUJFWSA-N |
| XLogP | 1.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |