C17H18FN3O2S — CID 97078399
[(4aR,8aS)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl]-[1-(4-fluorophenyl)pyrazol-3-yl]methanone (PubChem CID 97078399) has the molecular formula C17H18FN3O2S and a molecular weight of 347.42 g/mol. Its IUPAC name is [(4aR,8aS)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl]-[1-(4-fluorophenyl)pyrazol-3-yl]methanone.
| Compound Name | [(4aR,8aS)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl]-[1-(4-fluorophenyl)pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 97078399 |
| Molecular Formula | C17H18FN3O2S |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | [(4aR,8aS)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl]-[1-(4-fluorophenyl)pyrazol-3-yl]methanone |
| SMILES | O=C(c1ccn(-c2ccc(F)cc2)n1)N1CCS[C@H]2COCC[C@@H]21 |
| InChI | InChI=1S/C17H18FN3O2S/c18-12-1-3-13(4-2-12)21-7-5-14(19-21)17(22)20-8-10-24-16-11-23-9-6-15(16)20/h1-5,7,15-16H,6,8-11H2/t15-,16-/m0/s1 |
| InChIKey | HXVAZODKKVGSGV-HOTGVXAUSA-N |
| XLogP | 2.36 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |