C19H25N3O2 — CID 97078426
[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[(2R)-1-(pyridine-3-carbonyl)piperidin-2-yl]methanone (PubChem CID 97078426) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is [(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[(2R)-1-(pyridine-3-carbonyl)piperidin-2-yl]methanone.
| Compound Name | [(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[(2R)-1-(pyridine-3-carbonyl)piperidin-2-yl]methanone |
|---|---|
| PubChem CID | 97078426 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | [(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[(2R)-1-(pyridine-3-carbonyl)piperidin-2-yl]methanone |
| SMILES | O=C([C@H]1CCCCN1C(=O)c1cccnc1)N1C[C@H]2CCC[C@H]2C1 |
| InChI | InChI=1S/C19H25N3O2/c23-18(14-7-4-9-20-11-14)22-10-2-1-8-17(22)19(24)21-12-15-5-3-6-16(15)13-21/h4,7,9,11,15-17H,1-3,5-6,8,10,12-13H2/t15-,16+,17-/m1/s1 |
| InChIKey | CJKWMFJZUMXDKO-IXDOHACOSA-N |
| XLogP | 2.33 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |