C19H30N2O — CID 97078882
(3R,5S)-1-benzyl-5-[[(4-methylcyclohexyl)amino]methyl]pyrrolidin-3-ol (PubChem CID 97078882) has the molecular formula C19H30N2O and a molecular weight of 302.46 g/mol. Its IUPAC name is (3R,5S)-1-benzyl-5-[[(4-methylcyclohexyl)amino]methyl]pyrrolidin-3-ol.
| Compound Name | (3R,5S)-1-benzyl-5-[[(4-methylcyclohexyl)amino]methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 97078882 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | (3R,5S)-1-benzyl-5-[[(4-methylcyclohexyl)amino]methyl]pyrrolidin-3-ol |
| SMILES | CC1CCC(NC[C@@H]2C[C@@H](O)CN2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H30N2O/c1-15-7-9-17(10-8-15)20-12-18-11-19(22)14-21(18)13-16-5-3-2-4-6-16/h2-6,15,17-20,22H,7-14H2,1H3/t15?,17?,18-,19+/m0/s1 |
| InChIKey | FAJGGXYGGWMBIT-SOTJZCEJSA-N |
| XLogP | 2.79 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |