About [2-[[[(4S)-spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]methyl]phenyl]methanol
[2-[[[(4S)-spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]methyl]phenyl]methanol (PubChem CID 97080014) has the molecular formula C20H23NO2
and a molecular weight of 309.41 g/mol. Its IUPAC name is [2-[[[(4S)-spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]methyl]phenyl]methanol.
Molecular Properties
| Compound Name | [2-[[[(4S)-spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]methyl]phenyl]methanol |
| PubChem CID | 97080014 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | [2-[[[(4S)-spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]methyl]phenyl]methanol |
| SMILES | OCc1ccccc1CN[C@H]1CC2(CCC2)Oc2ccccc21 |
| InChI | InChI=1S/C20H23NO2/c22-14-16-7-2-1-6-15(16)13-21-18-12-20(10-5-11-20)23-19-9-4-3-8-17(18)19/h1-4,6-9,18,21-22H,5,10-14H2/t18-/m0/s1 |
| InChIKey | JKDZLIYHLXSSKF-SFHVURJKSA-N |
| XLogP | 3.71 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-[[[(4S)-spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]methyl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[[(4S)-spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]methyl]phenyl]methanol?
The IUPAC name of [2-[[[(4S)-spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]methyl]phenyl]methanol (CID 97080014) is [2-[[[(4S)-spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]methyl]phenyl]methanol.
What is the SMILES notation for [2-[[[(4S)-spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]methyl]phenyl]methanol?
The canonical SMILES for [2-[[[(4S)-spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]methyl]phenyl]methanol is OCc1ccccc1CN[C@H]1CC2(CCC2)Oc2ccccc21.
What is the InChIKey of [2-[[[(4S)-spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]methyl]phenyl]methanol?
The InChIKey is JKDZLIYHLXSSKF-SFHVURJKSA-N. The full InChI is InChI=1S/C20H23NO2/c22-14-16-7-2-1-6-15(16)13-21-18-12-20(10-5-11-20)23-19-9-4-3-8-17(18)19/h1-4,6-9,18,21-22H,5,10-14H2/t18-/m0/s1.
What are the key properties of [2-[[[(4S)-spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]methyl]phenyl]methanol?
[2-[[[(4S)-spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]methyl]phenyl]methanol has a molecular weight of 309.41 g/mol, XLogP of 3.71, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[[(4S)-spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]methyl]phenyl]methanol is sourced from PubChem (CID 97080014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).