C19H31N3O2 — CID 97080256
(3S)-3-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]-N-cyclopentylpiperidine-1-carboxamide (PubChem CID 97080256) has the molecular formula C19H31N3O2 and a molecular weight of 333.48 g/mol. Its IUPAC name is (3S)-3-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]-N-cyclopentylpiperidine-1-carboxamide.
| Compound Name | (3S)-3-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]-N-cyclopentylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 97080256 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | (3S)-3-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]-N-cyclopentylpiperidine-1-carboxamide |
| SMILES | O=C(NC1CCCC1)N1CCC[C@H](C(=O)N2C[C@H]3CCC[C@H]3C2)C1 |
| InChI | InChI=1S/C19H31N3O2/c23-18(22-11-14-5-3-6-15(14)12-22)16-7-4-10-21(13-16)19(24)20-17-8-1-2-9-17/h14-17H,1-13H2,(H,20,24)/t14-,15+,16-/m0/s1 |
| InChIKey | DKGNHLNUMRULMN-XHSDSOJGSA-N |
| XLogP | 2.61 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |