C18H32N4O2 — CID 97080337
1-[(3S)-1-cyclohexyl-5-oxopyrrolidin-3-yl]-3-(3-pyrrolidin-1-ylpropyl)urea (PubChem CID 97080337) has the molecular formula C18H32N4O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 1-[(3S)-1-cyclohexyl-5-oxopyrrolidin-3-yl]-3-(3-pyrrolidin-1-ylpropyl)urea.
| Compound Name | 1-[(3S)-1-cyclohexyl-5-oxopyrrolidin-3-yl]-3-(3-pyrrolidin-1-ylpropyl)urea |
|---|---|
| PubChem CID | 97080337 |
| Molecular Formula | C18H32N4O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | 1-[(3S)-1-cyclohexyl-5-oxopyrrolidin-3-yl]-3-(3-pyrrolidin-1-ylpropyl)urea |
| SMILES | O=C(NCCCN1CCCC1)N[C@H]1CC(=O)N(C2CCCCC2)C1 |
| InChI | InChI=1S/C18H32N4O2/c23-17-13-15(14-22(17)16-7-2-1-3-8-16)20-18(24)19-9-6-12-21-10-4-5-11-21/h15-16H,1-14H2,(H2,19,20,24)/t15-/m0/s1 |
| InChIKey | COZFZRZSSVDLBM-HNNXBMFYSA-N |
| XLogP | 1.71 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|