C19H35N3O2 — CID 97080390
1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[[1-(2-hydroxyethyl)piperidin-4-yl]methylamino]ethanone (PubChem CID 97080390) has the molecular formula C19H35N3O2 and a molecular weight of 337.51 g/mol. Its IUPAC name is 1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[[1-(2-hydroxyethyl)piperidin-4-yl]methylamino]ethanone.
| Compound Name | 1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[[1-(2-hydroxyethyl)piperidin-4-yl]methylamino]ethanone |
|---|---|
| PubChem CID | 97080390 |
| Molecular Formula | C19H35N3O2 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.27 |
| IUPAC Name | 1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[[1-(2-hydroxyethyl)piperidin-4-yl]methylamino]ethanone |
| SMILES | O=C(CNCC1CCN(CCO)CC1)N1CCC[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C19H35N3O2/c23-13-12-21-10-7-16(8-11-21)14-20-15-19(24)22-9-3-5-17-4-1-2-6-18(17)22/h16-18,20,23H,1-15H2/t17-,18+/m0/s1 |
| InChIKey | XQTMIRISSBTASP-ZWKOTPCHSA-N |
| XLogP | 1.46 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |