C17H26F3N3O — CID 97080660
1-(1-adamantyl)-3-[(3R)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]urea (PubChem CID 97080660) has the molecular formula C17H26F3N3O and a molecular weight of 345.41 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[(3R)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]urea.
| Compound Name | 1-(1-adamantyl)-3-[(3R)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 97080660 |
| Molecular Formula | C17H26F3N3O |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | 1-(1-adamantyl)-3-[(3R)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]urea |
| SMILES | O=C(N[C@@H]1CCN(CC(F)(F)F)C1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H26F3N3O/c18-17(19,20)10-23-2-1-14(9-23)21-15(24)22-16-6-11-3-12(7-16)5-13(4-11)8-16/h11-14H,1-10H2,(H2,21,22,24)/t11?,12?,13?,14-,16?/m1/s1 |
| InChIKey | RJFRVXAPALOJGP-MHCOZEDOSA-N |
| XLogP | 2.89 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |