C18H21N3O2 — CID 97080910
1-phenyl-4-[(3R)-3-(1H-pyrazol-5-yl)piperidin-1-yl]butane-1,4-dione (PubChem CID 97080910) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is 1-phenyl-4-[(3R)-3-(1H-pyrazol-5-yl)piperidin-1-yl]butane-1,4-dione.
| Compound Name | 1-phenyl-4-[(3R)-3-(1H-pyrazol-5-yl)piperidin-1-yl]butane-1,4-dione |
|---|---|
| PubChem CID | 97080910 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 1-phenyl-4-[(3R)-3-(1H-pyrazol-5-yl)piperidin-1-yl]butane-1,4-dione |
| SMILES | O=C(CCC(=O)N1CCC[C@@H](c2ccn[nH]2)C1)c1ccccc1 |
| InChI | InChI=1S/C18H21N3O2/c22-17(14-5-2-1-3-6-14)8-9-18(23)21-12-4-7-15(13-21)16-10-11-19-20-16/h1-3,5-6,10-11,15H,4,7-9,12-13H2,(H,19,20)/t15-/m1/s1 |
| InChIKey | WFJLZCYECWNARF-OAHLLOKOSA-N |
| XLogP | 2.78 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |