C18H24N6O — CID 97082351
(4aS,7aR)-4-benzyl-6-[(1-cyclopropyltetrazol-5-yl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine (PubChem CID 97082351) has the molecular formula C18H24N6O and a molecular weight of 340.43 g/mol. Its IUPAC name is (4aS,7aR)-4-benzyl-6-[(1-cyclopropyltetrazol-5-yl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aS,7aR)-4-benzyl-6-[(1-cyclopropyltetrazol-5-yl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 97082351 |
| Molecular Formula | C18H24N6O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (4aS,7aR)-4-benzyl-6-[(1-cyclopropyltetrazol-5-yl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
| SMILES | c1ccc(CN2CCO[C@@H]3CN(Cc4nnnn4C4CC4)C[C@@H]32)cc1 |
| InChI | InChI=1S/C18H24N6O/c1-2-4-14(5-3-1)10-23-8-9-25-17-12-22(11-16(17)23)13-18-19-20-21-24(18)15-6-7-15/h1-5,15-17H,6-13H2/t16-,17+/m0/s1 |
| InChIKey | GTKCXLVIBXQIHS-DLBZAZTESA-N |
| XLogP | 1.09 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |