C18H19N3O3 — CID 97082817
(4R)-2-oxo-N-[[3-(phenoxymethyl)phenyl]methyl]imidazolidine-4-carboxamide (PubChem CID 97082817) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is (4R)-2-oxo-N-[[3-(phenoxymethyl)phenyl]methyl]imidazolidine-4-carboxamide.
| Compound Name | (4R)-2-oxo-N-[[3-(phenoxymethyl)phenyl]methyl]imidazolidine-4-carboxamide |
|---|---|
| PubChem CID | 97082817 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | (4R)-2-oxo-N-[[3-(phenoxymethyl)phenyl]methyl]imidazolidine-4-carboxamide |
| SMILES | O=C1NC[C@H](C(=O)NCc2cccc(COc3ccccc3)c2)N1 |
| InChI | InChI=1S/C18H19N3O3/c22-17(16-11-20-18(23)21-16)19-10-13-5-4-6-14(9-13)12-24-15-7-2-1-3-8-15/h1-9,16H,10-12H2,(H,19,22)(H2,20,21,23)/t16-/m1/s1 |
| InChIKey | QTVUZIIJEOQDIP-MRXNPFEDSA-N |
| XLogP | 1.56 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |