C15H14N4O2 — CID 97082937
3-[(3R)-oxolan-3-yl]-5-(3-phenyl-1H-pyrazol-5-yl)-1,2,4-oxadiazole (PubChem CID 97082937) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is 3-[(3R)-oxolan-3-yl]-5-(3-phenyl-1H-pyrazol-5-yl)-1,2,4-oxadiazole.
| Compound Name | 3-[(3R)-oxolan-3-yl]-5-(3-phenyl-1H-pyrazol-5-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 97082937 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 3-[(3R)-oxolan-3-yl]-5-(3-phenyl-1H-pyrazol-5-yl)-1,2,4-oxadiazole |
| SMILES | c1ccc(-c2cc(-c3nc([C@H]4CCOC4)no3)[nH]n2)cc1 |
| InChI | InChI=1S/C15H14N4O2/c1-2-4-10(5-3-1)12-8-13(18-17-12)15-16-14(19-21-15)11-6-7-20-9-11/h1-5,8,11H,6-7,9H2,(H,17,18)/t11-/m0/s1 |
| InChIKey | SDOXQPIEBSKWEF-NSHDSACASA-N |
| XLogP | 2.63 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |