About (2S)-N-[4-(2,4-difluorophenyl)oxan-4-yl]-2-(2-methoxyethoxy)propanamide
(2S)-N-[4-(2,4-difluorophenyl)oxan-4-yl]-2-(2-methoxyethoxy)propanamide (PubChem CID 97083128) has the molecular formula C17H23F2NO4
and a molecular weight of 343.37 g/mol. Its IUPAC name is (2S)-N-[4-(2,4-difluorophenyl)oxan-4-yl]-2-(2-methoxyethoxy)propanamide.
Molecular Properties
| Compound Name | (2S)-N-[4-(2,4-difluorophenyl)oxan-4-yl]-2-(2-methoxyethoxy)propanamide |
| PubChem CID | 97083128 |
| Molecular Formula | C17H23F2NO4 |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (2S)-N-[4-(2,4-difluorophenyl)oxan-4-yl]-2-(2-methoxyethoxy)propanamide |
| SMILES | COCCO[C@@H](C)C(=O)NC1(c2ccc(F)cc2F)CCOCC1 |
| InChI | InChI=1S/C17H23F2NO4/c1-12(24-10-9-22-2)16(21)20-17(5-7-23-8-6-17)14-4-3-13(18)11-15(14)19/h3-4,11-12H,5-10H2,1-2H3,(H,20,21)/t12-/m0/s1 |
| InChIKey | DXMSOXYOQJUJPS-LBPRGKRZSA-N |
| XLogP | 2.14 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-N-[4-(2,4-difluorophenyl)oxan-4-yl]-2-(2-methoxyethoxy)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-[4-(2,4-difluorophenyl)oxan-4-yl]-2-(2-methoxyethoxy)propanamide?
The IUPAC name of (2S)-N-[4-(2,4-difluorophenyl)oxan-4-yl]-2-(2-methoxyethoxy)propanamide (CID 97083128) is (2S)-N-[4-(2,4-difluorophenyl)oxan-4-yl]-2-(2-methoxyethoxy)propanamide.
What is the SMILES notation for (2S)-N-[4-(2,4-difluorophenyl)oxan-4-yl]-2-(2-methoxyethoxy)propanamide?
The canonical SMILES for (2S)-N-[4-(2,4-difluorophenyl)oxan-4-yl]-2-(2-methoxyethoxy)propanamide is COCCO[C@@H](C)C(=O)NC1(c2ccc(F)cc2F)CCOCC1.
What is the InChIKey of (2S)-N-[4-(2,4-difluorophenyl)oxan-4-yl]-2-(2-methoxyethoxy)propanamide?
The InChIKey is DXMSOXYOQJUJPS-LBPRGKRZSA-N. The full InChI is InChI=1S/C17H23F2NO4/c1-12(24-10-9-22-2)16(21)20-17(5-7-23-8-6-17)14-4-3-13(18)11-15(14)19/h3-4,11-12H,5-10H2,1-2H3,(H,20,21)/t12-/m0/s1.
What are the key properties of (2S)-N-[4-(2,4-difluorophenyl)oxan-4-yl]-2-(2-methoxyethoxy)propanamide?
(2S)-N-[4-(2,4-difluorophenyl)oxan-4-yl]-2-(2-methoxyethoxy)propanamide has a molecular weight of 343.37 g/mol, XLogP of 2.14, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-[4-(2,4-difluorophenyl)oxan-4-yl]-2-(2-methoxyethoxy)propanamide is sourced from PubChem (CID 97083128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).