C15H17N5O2 — CID 97083310
(4S)-2-oxo-N-[3-(1,2,4-triazol-1-yl)propyl]-3,4-dihydro-1H-quinoline-4-carboxamide (PubChem CID 97083310) has the molecular formula C15H17N5O2 and a molecular weight of 299.33 g/mol. Its IUPAC name is (4S)-2-oxo-N-[3-(1,2,4-triazol-1-yl)propyl]-3,4-dihydro-1H-quinoline-4-carboxamide.
| Compound Name | (4S)-2-oxo-N-[3-(1,2,4-triazol-1-yl)propyl]-3,4-dihydro-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 97083310 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | (4S)-2-oxo-N-[3-(1,2,4-triazol-1-yl)propyl]-3,4-dihydro-1H-quinoline-4-carboxamide |
| SMILES | O=C1C[C@H](C(=O)NCCCn2cncn2)c2ccccc2N1 |
| InChI | InChI=1S/C15H17N5O2/c21-14-8-12(11-4-1-2-5-13(11)19-14)15(22)17-6-3-7-20-10-16-9-18-20/h1-2,4-5,9-10,12H,3,6-8H2,(H,17,22)(H,19,21)/t12-/m0/s1 |
| InChIKey | LJDFTTOPLQHMIW-LBPRGKRZSA-N |
| XLogP | 0.91 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|