C20H21N3O — CID 97084572
trans-(1S,2S)-N-(3-imidazol-1-ylpropyl)-2-naphthalen-2-ylcyclopropane-1-carboxamide (PubChem CID 97084572) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is trans-(1S,2S)-N-(3-imidazol-1-ylpropyl)-2-naphthalen-2-ylcyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-N-(3-imidazol-1-ylpropyl)-2-naphthalen-2-ylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 97084572 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | trans-(1S,2S)-N-(3-imidazol-1-ylpropyl)-2-naphthalen-2-ylcyclopropane-1-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)[C@H]1C[C@@H]1c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H21N3O/c24-20(22-8-3-10-23-11-9-21-14-23)19-13-18(19)17-7-6-15-4-1-2-5-16(15)12-17/h1-2,4-7,9,11-12,14,18-19H,3,8,10,13H2,(H,22,24)/t18-,19+/m1/s1 |
| InChIKey | PDJFUEDSJUUHGP-MOPGFXCFSA-N |
| XLogP | 3.35 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|