C28H24N2O4 — CID 97084601
1-[(3R,3aR,7Z)-3-(furan-2-yl)-7-(furan-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-naphthalen-2-yloxyethanone (PubChem CID 97084601) has the molecular formula C28H24N2O4 and a molecular weight of 452.51 g/mol. Its IUPAC name is 1-[(3R,3aR,7Z)-3-(furan-2-yl)-7-(furan-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-naphthalen-2-yloxyethanone.
| Compound Name | 1-[(3R,3aR,7Z)-3-(furan-2-yl)-7-(furan-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-naphthalen-2-yloxyethanone |
|---|---|
| PubChem CID | 97084601 |
| Molecular Formula | C28H24N2O4 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 1-[(3R,3aR,7Z)-3-(furan-2-yl)-7-(furan-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-naphthalen-2-yloxyethanone |
| SMILES | O=C(COc1ccc2ccccc2c1)N1N=C2/C(=C\c3ccco3)CCC[C@@H]2[C@@H]1c1ccco1 |
| InChI | InChI=1S/C28H24N2O4/c31-26(18-34-23-13-12-19-6-1-2-7-20(19)16-23)30-28(25-11-5-15-33-25)24-10-3-8-21(27(24)29-30)17-22-9-4-14-32-22/h1-2,4-7,9,11-17,24,28H,3,8,10,18H2/b21-17-/t24-,28+/m0/s1 |
| InChIKey | IUTZPWPFTIJSEN-OJZLATTGSA-N |
| XLogP | 6.23 |
| TPSA | 68.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |