C25H36N4O3 — CID 97085680
2-[2,6-di(propan-2-yl)anilino]ethyl (2S,3R)-1-methyl-2-(1-methylpyrazol-4-yl)-6-oxopiperidine-3-carboxylate (PubChem CID 97085680) has the molecular formula C25H36N4O3 and a molecular weight of 440.59 g/mol. Its IUPAC name is 2-[2,6-di(propan-2-yl)anilino]ethyl (2S,3R)-1-methyl-2-(1-methylpyrazol-4-yl)-6-oxopiperidine-3-carboxylate.
| Compound Name | 2-[2,6-di(propan-2-yl)anilino]ethyl (2S,3R)-1-methyl-2-(1-methylpyrazol-4-yl)-6-oxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 97085680 |
| Molecular Formula | C25H36N4O3 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | 2-[2,6-di(propan-2-yl)anilino]ethyl (2S,3R)-1-methyl-2-(1-methylpyrazol-4-yl)-6-oxopiperidine-3-carboxylate |
| SMILES | CC(C)c1cccc(C(C)C)c1NCCOC(=O)[C@@H]1CCC(=O)N(C)C1c1cnn(C)c1 |
| InChI | InChI=1S/C25H36N4O3/c1-16(2)19-8-7-9-20(17(3)4)23(19)26-12-13-32-25(31)21-10-11-22(30)29(6)24(21)18-14-27-28(5)15-18/h7-9,14-17,21,24,26H,10-13H2,1-6H3/t21-,24?/m1/s1 |
| InChIKey | WJGZWDLFWJNWCG-CILPGNKCSA-N |
| XLogP | 4.23 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|