C18H22N2O3S — CID 97086951
4-methoxy-N-[(3S)-3-[(R)-methylsulfinyl]butyl]-3-pyridin-2-ylbenzamide (PubChem CID 97086951) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is 4-methoxy-N-[(3S)-3-[(R)-methylsulfinyl]butyl]-3-pyridin-2-ylbenzamide.
| Compound Name | 4-methoxy-N-[(3S)-3-[(R)-methylsulfinyl]butyl]-3-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 97086951 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 4-methoxy-N-[(3S)-3-[(R)-methylsulfinyl]butyl]-3-pyridin-2-ylbenzamide |
| SMILES | COc1ccc(C(=O)NCC[C@H](C)[S@@](C)=O)cc1-c1ccccn1 |
| InChI | InChI=1S/C18H22N2O3S/c1-13(24(3)22)9-11-20-18(21)14-7-8-17(23-2)15(12-14)16-6-4-5-10-19-16/h4-8,10,12-13H,9,11H2,1-3H3,(H,20,21)/t13-,24+/m0/s1 |
| InChIKey | HNUNYSIGILOJMW-RKNYENMMSA-N |
| XLogP | 2.64 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |