C15H31N3O — CID 97087184
(2R)-N-(2-methylbutan-2-yl)-2-[methyl(2-pyrrolidin-1-ylethyl)amino]propanamide (PubChem CID 97087184) has the molecular formula C15H31N3O and a molecular weight of 269.43 g/mol. Its IUPAC name is (2R)-N-(2-methylbutan-2-yl)-2-[methyl(2-pyrrolidin-1-ylethyl)amino]propanamide.
| Compound Name | (2R)-N-(2-methylbutan-2-yl)-2-[methyl(2-pyrrolidin-1-ylethyl)amino]propanamide |
|---|---|
| PubChem CID | 97087184 |
| Molecular Formula | C15H31N3O |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.25 |
| IUPAC Name | (2R)-N-(2-methylbutan-2-yl)-2-[methyl(2-pyrrolidin-1-ylethyl)amino]propanamide |
| SMILES | CCC(C)(C)NC(=O)[C@@H](C)N(C)CCN1CCCC1 |
| InChI | InChI=1S/C15H31N3O/c1-6-15(3,4)16-14(19)13(2)17(5)11-12-18-9-7-8-10-18/h13H,6-12H2,1-5H3,(H,16,19)/t13-/m1/s1 |
| InChIKey | QYUIDNONOSYADH-CYBMUJFWSA-N |
| XLogP | 1.71 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |