C16H20N2O2S2 — CID 97087435
1-[[4-[(S)-methylsulfinyl]phenyl]methyl]-3-[(2R)-2-thiophen-2-ylpropyl]urea (PubChem CID 97087435) has the molecular formula C16H20N2O2S2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 1-[[4-[(S)-methylsulfinyl]phenyl]methyl]-3-[(2R)-2-thiophen-2-ylpropyl]urea.
| Compound Name | 1-[[4-[(S)-methylsulfinyl]phenyl]methyl]-3-[(2R)-2-thiophen-2-ylpropyl]urea |
|---|---|
| PubChem CID | 97087435 |
| Molecular Formula | C16H20N2O2S2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 1-[[4-[(S)-methylsulfinyl]phenyl]methyl]-3-[(2R)-2-thiophen-2-ylpropyl]urea |
| SMILES | C[C@H](CNC(=O)NCc1ccc([S@](C)=O)cc1)c1cccs1 |
| InChI | InChI=1S/C16H20N2O2S2/c1-12(15-4-3-9-21-15)10-17-16(19)18-11-13-5-7-14(8-6-13)22(2)20/h3-9,12H,10-11H2,1-2H3,(H2,17,18,19)/t12-,22+/m1/s1 |
| InChIKey | FNBSYHTYAMQBMH-IPQOISQHSA-N |
| XLogP | 3.09 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |