C10H9Cl2F3N2O2 — CID 97087482
3,6-dichloro-N-[(2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropyl]pyridine-2-carboxamide (PubChem CID 97087482) has the molecular formula C10H9Cl2F3N2O2 and a molecular weight of 317.09 g/mol. Its IUPAC name is 3,6-dichloro-N-[(2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropyl]pyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[(2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 97087482 |
| Molecular Formula | C10H9Cl2F3N2O2 |
| Molecular Weight | 317.09 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | 3,6-dichloro-N-[(2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropyl]pyridine-2-carboxamide |
| SMILES | C[C@@](O)(CNC(=O)c1nc(Cl)ccc1Cl)C(F)(F)F |
| InChI | InChI=1S/C10H9Cl2F3N2O2/c1-9(19,10(13,14)15)4-16-8(18)7-5(11)2-3-6(12)17-7/h2-3,19H,4H2,1H3,(H,16,18)/t9-/m1/s1 |
| InChIKey | JQXDJPGMLWGBIW-SECBINFHSA-N |
| XLogP | 2.43 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.09 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|