C16H21NOS — CID 97087782
(2R,3R)-3-[(2R)-1-quinolin-2-ylpropan-2-yl]sulfanylbutan-2-ol (PubChem CID 97087782) has the molecular formula C16H21NOS and a molecular weight of 275.42 g/mol. Its IUPAC name is (2R,3R)-3-[(2R)-1-quinolin-2-ylpropan-2-yl]sulfanylbutan-2-ol.
| Compound Name | (2R,3R)-3-[(2R)-1-quinolin-2-ylpropan-2-yl]sulfanylbutan-2-ol |
|---|---|
| PubChem CID | 97087782 |
| Molecular Formula | C16H21NOS |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (2R,3R)-3-[(2R)-1-quinolin-2-ylpropan-2-yl]sulfanylbutan-2-ol |
| SMILES | C[C@H](Cc1ccc2ccccc2n1)S[C@H](C)[C@@H](C)O |
| InChI | InChI=1S/C16H21NOS/c1-11(19-13(3)12(2)18)10-15-9-8-14-6-4-5-7-16(14)17-15/h4-9,11-13,18H,10H2,1-3H3/t11-,12-,13-/m1/s1 |
| InChIKey | MDARMRPECQSWGD-JHJVBQTASA-N |
| XLogP | 3.67 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |