C13H18FNO3S — CID 97088403
(2R)-N-[(1S)-1-(4-fluorophenyl)ethyl]-2-[(S)-2-hydroxyethylsulfinyl]propanamide (PubChem CID 97088403) has the molecular formula C13H18FNO3S and a molecular weight of 287.36 g/mol. Its IUPAC name is (2R)-N-[(1S)-1-(4-fluorophenyl)ethyl]-2-[(S)-2-hydroxyethylsulfinyl]propanamide.
| Compound Name | (2R)-N-[(1S)-1-(4-fluorophenyl)ethyl]-2-[(S)-2-hydroxyethylsulfinyl]propanamide |
|---|---|
| PubChem CID | 97088403 |
| Molecular Formula | C13H18FNO3S |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | (2R)-N-[(1S)-1-(4-fluorophenyl)ethyl]-2-[(S)-2-hydroxyethylsulfinyl]propanamide |
| SMILES | C[C@H](NC(=O)[C@@H](C)[S@@](=O)CCO)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H18FNO3S/c1-9(11-3-5-12(14)6-4-11)15-13(17)10(2)19(18)8-7-16/h3-6,9-10,16H,7-8H2,1-2H3,(H,15,17)/t9-,10+,19-/m0/s1 |
| InChIKey | BFTJPKVFMJYKLZ-DQPNGWRMSA-N |
| XLogP | 1.13 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |