C24H34F3N3O — CID 97088683
(2S)-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]pyrrolidine-2-carboxamide (PubChem CID 97088683) has the molecular formula C24H34F3N3O and a molecular weight of 437.55 g/mol. Its IUPAC name is (2S)-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 97088683 |
| Molecular Formula | C24H34F3N3O |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | (2S)-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]pyrrolidine-2-carboxamide |
| SMILES | C[C@H](NC(=O)[C@@H]1CCCN1C1CCN(CC(F)(F)F)CC1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C24H34F3N3O/c1-17(19-9-8-18-5-2-3-6-20(18)15-19)28-23(31)22-7-4-12-30(22)21-10-13-29(14-11-21)16-24(25,26)27/h8-9,15,17,21-22H,2-7,10-14,16H2,1H3,(H,28,31)/t17-,22-/m0/s1 |
| InChIKey | NEFHOOWMPJESDE-JTSKRJEESA-N |
| XLogP | 4.23 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |