C22H29NO3 — CID 97088707
(1S)-N-[[5-methoxy-2-(methoxymethoxy)phenyl]methyl]-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanamine (PubChem CID 97088707) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is (1S)-N-[[5-methoxy-2-(methoxymethoxy)phenyl]methyl]-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanamine.
| Compound Name | (1S)-N-[[5-methoxy-2-(methoxymethoxy)phenyl]methyl]-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanamine |
|---|---|
| PubChem CID | 97088707 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | (1S)-N-[[5-methoxy-2-(methoxymethoxy)phenyl]methyl]-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanamine |
| SMILES | COCOc1ccc(OC)cc1CN[C@@H](C)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C22H29NO3/c1-16(18-9-8-17-6-4-5-7-19(17)12-18)23-14-20-13-21(25-3)10-11-22(20)26-15-24-2/h8-13,16,23H,4-7,14-15H2,1-3H3/t16-/m0/s1 |
| InChIKey | IFBKYWDEFIUWPG-INIZCTEOSA-N |
| XLogP | 4.41 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|