C15H20O4 — CID 97088891
[(1S)-1-(3-methoxyphenyl)ethyl] (3R)-oxane-3-carboxylate (PubChem CID 97088891) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is [(1S)-1-(3-methoxyphenyl)ethyl] (3R)-oxane-3-carboxylate.
| Compound Name | [(1S)-1-(3-methoxyphenyl)ethyl] (3R)-oxane-3-carboxylate |
|---|---|
| PubChem CID | 97088891 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | [(1S)-1-(3-methoxyphenyl)ethyl] (3R)-oxane-3-carboxylate |
| SMILES | COc1cccc([C@H](C)OC(=O)[C@@H]2CCCOC2)c1 |
| InChI | InChI=1S/C15H20O4/c1-11(12-5-3-7-14(9-12)17-2)19-15(16)13-6-4-8-18-10-13/h3,5,7,9,11,13H,4,6,8,10H2,1-2H3/t11-,13+/m0/s1 |
| InChIKey | KAZGIJFKSDKIJX-WCQYABFASA-N |
| XLogP | 2.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |