C19H29N3O — CID 97089008
2-[(4aR,8aR)-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-N-[(1S)-1-phenylethyl]acetamide (PubChem CID 97089008) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is 2-[(4aR,8aR)-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-N-[(1S)-1-phenylethyl]acetamide.
| Compound Name | 2-[(4aR,8aR)-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-N-[(1S)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 97089008 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | 2-[(4aR,8aR)-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-N-[(1S)-1-phenylethyl]acetamide |
| SMILES | C[C@H](NC(=O)CN1CC[C@@H]2[C@H](CCCN2C)C1)c1ccccc1 |
| InChI | InChI=1S/C19H29N3O/c1-15(16-7-4-3-5-8-16)20-19(23)14-22-12-10-18-17(13-22)9-6-11-21(18)2/h3-5,7-8,15,17-18H,6,9-14H2,1-2H3,(H,20,23)/t15-,17+,18+/m0/s1 |
| InChIKey | GJJPFLFIMSHLBP-CGTJXYLNSA-N |
| XLogP | 2.28 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |