C15H16F3N3O — CID 97089043
4,4,4-trifluoro-N-[1-[(1S)-1-phenylethyl]pyrazol-3-yl]butanamide (PubChem CID 97089043) has the molecular formula C15H16F3N3O and a molecular weight of 311.31 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[1-[(1S)-1-phenylethyl]pyrazol-3-yl]butanamide.
| Compound Name | 4,4,4-trifluoro-N-[1-[(1S)-1-phenylethyl]pyrazol-3-yl]butanamide |
|---|---|
| PubChem CID | 97089043 |
| Molecular Formula | C15H16F3N3O |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 4,4,4-trifluoro-N-[1-[(1S)-1-phenylethyl]pyrazol-3-yl]butanamide |
| SMILES | C[C@@H](c1ccccc1)n1ccc(NC(=O)CCC(F)(F)F)n1 |
| InChI | InChI=1S/C15H16F3N3O/c1-11(12-5-3-2-4-6-12)21-10-8-13(20-21)19-14(22)7-9-15(16,17)18/h2-6,8,10-11H,7,9H2,1H3,(H,19,20,22)/t11-/m0/s1 |
| InChIKey | AYFBYDRWPWSIOI-NSHDSACASA-N |
| XLogP | 3.77 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |