About (1S)-N-[(2-cyclobutyl-1,3-thiazol-5-yl)methyl]-1-(2-pyrazol-1-ylphenyl)ethanamine
(1S)-N-[(2-cyclobutyl-1,3-thiazol-5-yl)methyl]-1-(2-pyrazol-1-ylphenyl)ethanamine (PubChem CID 97089159) has the molecular formula C19H22N4S
and a molecular weight of 338.48 g/mol. Its IUPAC name is (1S)-N-[(2-cyclobutyl-1,3-thiazol-5-yl)methyl]-1-(2-pyrazol-1-ylphenyl)ethanamine.
Molecular Properties
| Compound Name | (1S)-N-[(2-cyclobutyl-1,3-thiazol-5-yl)methyl]-1-(2-pyrazol-1-ylphenyl)ethanamine |
| PubChem CID | 97089159 |
| Molecular Formula | C19H22N4S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | (1S)-N-[(2-cyclobutyl-1,3-thiazol-5-yl)methyl]-1-(2-pyrazol-1-ylphenyl)ethanamine |
| SMILES | C[C@H](NCc1cnc(C2CCC2)s1)c1ccccc1-n1cccn1 |
| InChI | InChI=1S/C19H22N4S/c1-14(17-8-2-3-9-18(17)23-11-5-10-22-23)20-12-16-13-21-19(24-16)15-6-4-7-15/h2-3,5,8-11,13-15,20H,4,6-7,12H2,1H3/t14-/m0/s1 |
| InChIKey | XXCINKABCYJGMA-AWEZNQCLSA-N |
| XLogP | 4.45 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1S)-N-[(2-cyclobutyl-1,3-thiazol-5-yl)methyl]-1-(2-pyrazol-1-ylphenyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-N-[(2-cyclobutyl-1,3-thiazol-5-yl)methyl]-1-(2-pyrazol-1-ylphenyl)ethanamine?
The IUPAC name of (1S)-N-[(2-cyclobutyl-1,3-thiazol-5-yl)methyl]-1-(2-pyrazol-1-ylphenyl)ethanamine (CID 97089159) is (1S)-N-[(2-cyclobutyl-1,3-thiazol-5-yl)methyl]-1-(2-pyrazol-1-ylphenyl)ethanamine.
What is the SMILES notation for (1S)-N-[(2-cyclobutyl-1,3-thiazol-5-yl)methyl]-1-(2-pyrazol-1-ylphenyl)ethanamine?
The canonical SMILES for (1S)-N-[(2-cyclobutyl-1,3-thiazol-5-yl)methyl]-1-(2-pyrazol-1-ylphenyl)ethanamine is C[C@H](NCc1cnc(C2CCC2)s1)c1ccccc1-n1cccn1.
What is the InChIKey of (1S)-N-[(2-cyclobutyl-1,3-thiazol-5-yl)methyl]-1-(2-pyrazol-1-ylphenyl)ethanamine?
The InChIKey is XXCINKABCYJGMA-AWEZNQCLSA-N. The full InChI is InChI=1S/C19H22N4S/c1-14(17-8-2-3-9-18(17)23-11-5-10-22-23)20-12-16-13-21-19(24-16)15-6-4-7-15/h2-3,5,8-11,13-15,20H,4,6-7,12H2,1H3/t14-/m0/s1.
What are the key properties of (1S)-N-[(2-cyclobutyl-1,3-thiazol-5-yl)methyl]-1-(2-pyrazol-1-ylphenyl)ethanamine?
(1S)-N-[(2-cyclobutyl-1,3-thiazol-5-yl)methyl]-1-(2-pyrazol-1-ylphenyl)ethanamine has a molecular weight of 338.48 g/mol, XLogP of 4.45, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-N-[(2-cyclobutyl-1,3-thiazol-5-yl)methyl]-1-(2-pyrazol-1-ylphenyl)ethanamine is sourced from PubChem (CID 97089159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).