About (3S)-4-(3,4-dihydro-2H-pyran-6-carbonyl)-3-methylpiperazin-2-one
(3S)-4-(3,4-dihydro-2H-pyran-6-carbonyl)-3-methylpiperazin-2-one (PubChem CID 97090915) has the molecular formula C11H16N2O3
and a molecular weight of 224.26 g/mol. Its IUPAC name is (3S)-4-(3,4-dihydro-2H-pyran-6-carbonyl)-3-methylpiperazin-2-one.
Molecular Properties
| Compound Name | (3S)-4-(3,4-dihydro-2H-pyran-6-carbonyl)-3-methylpiperazin-2-one |
| PubChem CID | 97090915 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | (3S)-4-(3,4-dihydro-2H-pyran-6-carbonyl)-3-methylpiperazin-2-one |
| SMILES | C[C@H]1C(=O)NCCN1C(=O)C1=CCCCO1 |
| InChI | InChI=1S/C11H16N2O3/c1-8-10(14)12-5-6-13(8)11(15)9-4-2-3-7-16-9/h4,8H,2-3,5-7H2,1H3,(H,12,14)/t8-/m0/s1 |
| InChIKey | DOQPISTVNYQGQN-QMMMGPOBSA-N |
| XLogP | 0.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-4-(3,4-dihydro-2H-pyran-6-carbonyl)-3-methylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-4-(3,4-dihydro-2H-pyran-6-carbonyl)-3-methylpiperazin-2-one?
The IUPAC name of (3S)-4-(3,4-dihydro-2H-pyran-6-carbonyl)-3-methylpiperazin-2-one (CID 97090915) is (3S)-4-(3,4-dihydro-2H-pyran-6-carbonyl)-3-methylpiperazin-2-one.
What is the SMILES notation for (3S)-4-(3,4-dihydro-2H-pyran-6-carbonyl)-3-methylpiperazin-2-one?
The canonical SMILES for (3S)-4-(3,4-dihydro-2H-pyran-6-carbonyl)-3-methylpiperazin-2-one is C[C@H]1C(=O)NCCN1C(=O)C1=CCCCO1.
What is the InChIKey of (3S)-4-(3,4-dihydro-2H-pyran-6-carbonyl)-3-methylpiperazin-2-one?
The InChIKey is DOQPISTVNYQGQN-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H16N2O3/c1-8-10(14)12-5-6-13(8)11(15)9-4-2-3-7-16-9/h4,8H,2-3,5-7H2,1H3,(H,12,14)/t8-/m0/s1.
What are the key properties of (3S)-4-(3,4-dihydro-2H-pyran-6-carbonyl)-3-methylpiperazin-2-one?
(3S)-4-(3,4-dihydro-2H-pyran-6-carbonyl)-3-methylpiperazin-2-one has a molecular weight of 224.26 g/mol, XLogP of 0.03, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-4-(3,4-dihydro-2H-pyran-6-carbonyl)-3-methylpiperazin-2-one is sourced from PubChem (CID 97090915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).