C14H16BrClN2O3 — CID 97091548
trans-(1R,2R)-N-[3-(5-bromo-3-chloro-2-hydroxyanilino)-3-oxopropyl]-2-methylcyclopropane-1-carboxamide (PubChem CID 97091548) has the molecular formula C14H16BrClN2O3 and a molecular weight of 375.65 g/mol. Its IUPAC name is trans-(1R,2R)-N-[3-(5-bromo-3-chloro-2-hydroxyanilino)-3-oxopropyl]-2-methylcyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-[3-(5-bromo-3-chloro-2-hydroxyanilino)-3-oxopropyl]-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 97091548 |
| Molecular Formula | C14H16BrClN2O3 |
| Molecular Weight | 375.65 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | trans-(1R,2R)-N-[3-(5-bromo-3-chloro-2-hydroxyanilino)-3-oxopropyl]-2-methylcyclopropane-1-carboxamide |
| SMILES | C[C@@H]1C[C@H]1C(=O)NCCC(=O)Nc1cc(Br)cc(Cl)c1O |
| InChI | InChI=1S/C14H16BrClN2O3/c1-7-4-9(7)14(21)17-3-2-12(19)18-11-6-8(15)5-10(16)13(11)20/h5-7,9,20H,2-4H2,1H3,(H,17,21)(H,18,19)/t7-,9-/m1/s1 |
| InChIKey | XOZBABYOXUVRSL-VXNVDRBHSA-N |
| XLogP | 2.91 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.65 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|