C21H33N3O — CID 97093520
1-[(3R,4R)-4-[[4-(azepan-1-yl)phenyl]methylamino]-3-methylpiperidin-1-yl]ethanone (PubChem CID 97093520) has the molecular formula C21H33N3O and a molecular weight of 343.51 g/mol. Its IUPAC name is 1-[(3R,4R)-4-[[4-(azepan-1-yl)phenyl]methylamino]-3-methylpiperidin-1-yl]ethanone.
| Compound Name | 1-[(3R,4R)-4-[[4-(azepan-1-yl)phenyl]methylamino]-3-methylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 97093520 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | 1-[(3R,4R)-4-[[4-(azepan-1-yl)phenyl]methylamino]-3-methylpiperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CC[C@@H](NCc2ccc(N3CCCCCC3)cc2)[C@H](C)C1 |
| InChI | InChI=1S/C21H33N3O/c1-17-16-24(18(2)25)14-11-21(17)22-15-19-7-9-20(10-8-19)23-12-5-3-4-6-13-23/h7-10,17,21-22H,3-6,11-16H2,1-2H3/t17-,21-/m1/s1 |
| InChIKey | WBEGZDSPKJZTFM-DYESRHJHSA-N |
| XLogP | 3.41 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|