C18H25N3O — CID 97093757
1-[(2S)-2,4-dimethylpiperazin-1-yl]-4-(1H-indol-3-yl)butan-1-one (PubChem CID 97093757) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is 1-[(2S)-2,4-dimethylpiperazin-1-yl]-4-(1H-indol-3-yl)butan-1-one.
| Compound Name | 1-[(2S)-2,4-dimethylpiperazin-1-yl]-4-(1H-indol-3-yl)butan-1-one |
|---|---|
| PubChem CID | 97093757 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 1-[(2S)-2,4-dimethylpiperazin-1-yl]-4-(1H-indol-3-yl)butan-1-one |
| SMILES | C[C@H]1CN(C)CCN1C(=O)CCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H25N3O/c1-14-13-20(2)10-11-21(14)18(22)9-5-6-15-12-19-17-8-4-3-7-16(15)17/h3-4,7-8,12,14,19H,5-6,9-11,13H2,1-2H3/t14-/m0/s1 |
| InChIKey | PRQGLDNJLOLKDT-AWEZNQCLSA-N |
| XLogP | 2.65 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |