C17H21N3O2 — CID 97093863
1-[2-[(2S)-2,4-dimethylpiperazin-1-yl]-2-oxoethyl]quinolin-4-one (PubChem CID 97093863) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 1-[2-[(2S)-2,4-dimethylpiperazin-1-yl]-2-oxoethyl]quinolin-4-one.
| Compound Name | 1-[2-[(2S)-2,4-dimethylpiperazin-1-yl]-2-oxoethyl]quinolin-4-one |
|---|---|
| PubChem CID | 97093863 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 1-[2-[(2S)-2,4-dimethylpiperazin-1-yl]-2-oxoethyl]quinolin-4-one |
| SMILES | C[C@H]1CN(C)CCN1C(=O)Cn1ccc(=O)c2ccccc21 |
| InChI | InChI=1S/C17H21N3O2/c1-13-11-18(2)9-10-20(13)17(22)12-19-8-7-16(21)14-5-3-4-6-15(14)19/h3-8,13H,9-12H2,1-2H3/t13-/m0/s1 |
| InChIKey | GYXCXZGEQFDGAJ-ZDUSSCGKSA-N |
| XLogP | 1.16 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |