C18H22N4O — CID 97094498
2-[(3R)-4-(2-methoxyethyl)-3-methylpiperazin-1-yl]quinoline-6-carbonitrile (PubChem CID 97094498) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is 2-[(3R)-4-(2-methoxyethyl)-3-methylpiperazin-1-yl]quinoline-6-carbonitrile.
| Compound Name | 2-[(3R)-4-(2-methoxyethyl)-3-methylpiperazin-1-yl]quinoline-6-carbonitrile |
|---|---|
| PubChem CID | 97094498 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 2-[(3R)-4-(2-methoxyethyl)-3-methylpiperazin-1-yl]quinoline-6-carbonitrile |
| SMILES | COCCN1CCN(c2ccc3cc(C#N)ccc3n2)C[C@H]1C |
| InChI | InChI=1S/C18H22N4O/c1-14-13-22(8-7-21(14)9-10-23-2)18-6-4-16-11-15(12-19)3-5-17(16)20-18/h3-6,11,14H,7-10,13H2,1-2H3/t14-/m1/s1 |
| InChIKey | KFLONYSSPWSNIV-CQSZACIVSA-N |
| XLogP | 2.26 |
| TPSA | 52.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |