C21H32N2O3 — CID 97095254
N-[(1S,2S)-2-(3-methylbutoxy)cyclohexyl]-3-(propanoylamino)benzamide (PubChem CID 97095254) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is N-[(1S,2S)-2-(3-methylbutoxy)cyclohexyl]-3-(propanoylamino)benzamide.
| Compound Name | N-[(1S,2S)-2-(3-methylbutoxy)cyclohexyl]-3-(propanoylamino)benzamide |
|---|---|
| PubChem CID | 97095254 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | N-[(1S,2S)-2-(3-methylbutoxy)cyclohexyl]-3-(propanoylamino)benzamide |
| SMILES | CCC(=O)Nc1cccc(C(=O)N[C@H]2CCCC[C@@H]2OCCC(C)C)c1 |
| InChI | InChI=1S/C21H32N2O3/c1-4-20(24)22-17-9-7-8-16(14-17)21(25)23-18-10-5-6-11-19(18)26-13-12-15(2)3/h7-9,14-15,18-19H,4-6,10-13H2,1-3H3,(H,22,24)(H,23,25)/t18-,19-/m0/s1 |
| InChIKey | RRMMJWCNFXNKMN-OALUTQOASA-N |
| XLogP | 4.14 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |