C14H18N4OS — CID 97095551
1-(pyridin-4-ylmethyl)-3-[(2S)-2-(1,3-thiazol-2-yl)butan-2-yl]urea (PubChem CID 97095551) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is 1-(pyridin-4-ylmethyl)-3-[(2S)-2-(1,3-thiazol-2-yl)butan-2-yl]urea.
| Compound Name | 1-(pyridin-4-ylmethyl)-3-[(2S)-2-(1,3-thiazol-2-yl)butan-2-yl]urea |
|---|---|
| PubChem CID | 97095551 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 1-(pyridin-4-ylmethyl)-3-[(2S)-2-(1,3-thiazol-2-yl)butan-2-yl]urea |
| SMILES | CC[C@](C)(NC(=O)NCc1ccncc1)c1nccs1 |
| InChI | InChI=1S/C14H18N4OS/c1-3-14(2,12-16-8-9-20-12)18-13(19)17-10-11-4-6-15-7-5-11/h4-9H,3,10H2,1-2H3,(H2,17,18,19)/t14-/m0/s1 |
| InChIKey | ZWANGEJGZQEJJG-AWEZNQCLSA-N |
| XLogP | 2.66 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |