C17H32N2O3 — CID 97095706
(2R)-N-[(2S)-butan-2-yl]-2-[[(2R)-2-cycloheptyloxypropanoyl]amino]propanamide (PubChem CID 97095706) has the molecular formula C17H32N2O3 and a molecular weight of 312.45 g/mol. Its IUPAC name is (2R)-N-[(2S)-butan-2-yl]-2-[[(2R)-2-cycloheptyloxypropanoyl]amino]propanamide.
| Compound Name | (2R)-N-[(2S)-butan-2-yl]-2-[[(2R)-2-cycloheptyloxypropanoyl]amino]propanamide |
|---|---|
| PubChem CID | 97095706 |
| Molecular Formula | C17H32N2O3 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.24 |
| IUPAC Name | (2R)-N-[(2S)-butan-2-yl]-2-[[(2R)-2-cycloheptyloxypropanoyl]amino]propanamide |
| SMILES | CC[C@H](C)NC(=O)[C@@H](C)NC(=O)[C@@H](C)OC1CCCCCC1 |
| InChI | InChI=1S/C17H32N2O3/c1-5-12(2)18-16(20)13(3)19-17(21)14(4)22-15-10-8-6-7-9-11-15/h12-15H,5-11H2,1-4H3,(H,18,20)(H,19,21)/t12-,13+,14+/m0/s1 |
| InChIKey | QJDZKGPFIHRRAF-BFHYXJOUSA-N |
| XLogP | 2.53 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |