About 1-[1-(2,2-difluoroethyl)pyrazol-3-yl]-3-[(1S)-1-[(2S)-oxolan-2-yl]propyl]urea
1-[1-(2,2-difluoroethyl)pyrazol-3-yl]-3-[(1S)-1-[(2S)-oxolan-2-yl]propyl]urea (PubChem CID 97095878) has the molecular formula C13H20F2N4O2
and a molecular weight of 302.32 g/mol. Its IUPAC name is 1-[1-(2,2-difluoroethyl)pyrazol-3-yl]-3-[(1S)-1-[(2S)-oxolan-2-yl]propyl]urea.
Molecular Properties
| Compound Name | 1-[1-(2,2-difluoroethyl)pyrazol-3-yl]-3-[(1S)-1-[(2S)-oxolan-2-yl]propyl]urea |
| PubChem CID | 97095878 |
| Molecular Formula | C13H20F2N4O2 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 1-[1-(2,2-difluoroethyl)pyrazol-3-yl]-3-[(1S)-1-[(2S)-oxolan-2-yl]propyl]urea |
| SMILES | CC[C@H](NC(=O)Nc1ccn(CC(F)F)n1)[C@@H]1CCCO1 |
| InChI | InChI=1S/C13H20F2N4O2/c1-2-9(10-4-3-7-21-10)16-13(20)17-12-5-6-19(18-12)8-11(14)15/h5-6,9-11H,2-4,7-8H2,1H3,(H2,16,17,18,20)/t9-,10-/m0/s1 |
| InChIKey | LFQVCQJOPBOYQB-UWVGGRQHSA-N |
| XLogP | 2.23 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[1-(2,2-difluoroethyl)pyrazol-3-yl]-3-[(1S)-1-[(2S)-oxolan-2-yl]propyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(2,2-difluoroethyl)pyrazol-3-yl]-3-[(1S)-1-[(2S)-oxolan-2-yl]propyl]urea?
The IUPAC name of 1-[1-(2,2-difluoroethyl)pyrazol-3-yl]-3-[(1S)-1-[(2S)-oxolan-2-yl]propyl]urea (CID 97095878) is 1-[1-(2,2-difluoroethyl)pyrazol-3-yl]-3-[(1S)-1-[(2S)-oxolan-2-yl]propyl]urea.
What is the SMILES notation for 1-[1-(2,2-difluoroethyl)pyrazol-3-yl]-3-[(1S)-1-[(2S)-oxolan-2-yl]propyl]urea?
The canonical SMILES for 1-[1-(2,2-difluoroethyl)pyrazol-3-yl]-3-[(1S)-1-[(2S)-oxolan-2-yl]propyl]urea is CC[C@H](NC(=O)Nc1ccn(CC(F)F)n1)[C@@H]1CCCO1.
What is the InChIKey of 1-[1-(2,2-difluoroethyl)pyrazol-3-yl]-3-[(1S)-1-[(2S)-oxolan-2-yl]propyl]urea?
The InChIKey is LFQVCQJOPBOYQB-UWVGGRQHSA-N. The full InChI is InChI=1S/C13H20F2N4O2/c1-2-9(10-4-3-7-21-10)16-13(20)17-12-5-6-19(18-12)8-11(14)15/h5-6,9-11H,2-4,7-8H2,1H3,(H2,16,17,18,20)/t9-,10-/m0/s1.
What are the key properties of 1-[1-(2,2-difluoroethyl)pyrazol-3-yl]-3-[(1S)-1-[(2S)-oxolan-2-yl]propyl]urea?
1-[1-(2,2-difluoroethyl)pyrazol-3-yl]-3-[(1S)-1-[(2S)-oxolan-2-yl]propyl]urea has a molecular weight of 302.32 g/mol, XLogP of 2.23, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(2,2-difluoroethyl)pyrazol-3-yl]-3-[(1S)-1-[(2S)-oxolan-2-yl]propyl]urea is sourced from PubChem (CID 97095878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).