C17H23N3O2 — CID 97096373
(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(3-imidazol-1-ylpropyl)propan-1-amine (PubChem CID 97096373) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is (1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(3-imidazol-1-ylpropyl)propan-1-amine.
| Compound Name | (1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(3-imidazol-1-ylpropyl)propan-1-amine |
|---|---|
| PubChem CID | 97096373 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | (1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(3-imidazol-1-ylpropyl)propan-1-amine |
| SMILES | CC[C@H](NCCCn1ccnc1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H23N3O2/c1-2-15(19-6-3-8-20-9-7-18-13-20)14-4-5-16-17(12-14)22-11-10-21-16/h4-5,7,9,12-13,15,19H,2-3,6,8,10-11H2,1H3/t15-/m0/s1 |
| InChIKey | UFLCOPGXMSXBFM-HNNXBMFYSA-N |
| XLogP | 2.79 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|