About methyl 2-[[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]acetyl]-[(1S)-1-phenylpropyl]amino]acetate
methyl 2-[[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]acetyl]-[(1S)-1-phenylpropyl]amino]acetate (PubChem CID 97096397) has the molecular formula C18H23N3O5
and a molecular weight of 361.40 g/mol. Its IUPAC name is methyl 2-[[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]acetyl]-[(1S)-1-phenylpropyl]amino]acetate.
Molecular Properties
| Compound Name | methyl 2-[[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]acetyl]-[(1S)-1-phenylpropyl]amino]acetate |
| PubChem CID | 97096397 |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | methyl 2-[[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]acetyl]-[(1S)-1-phenylpropyl]amino]acetate |
| SMILES | CC[C@@H](c1ccccc1)N(CC(=O)OC)C(=O)COCc1nc(C)no1 |
| InChI | InChI=1S/C18H23N3O5/c1-4-15(14-8-6-5-7-9-14)21(10-18(23)24-3)17(22)12-25-11-16-19-13(2)20-26-16/h5-9,15H,4,10-12H2,1-3H3/t15-/m0/s1 |
| InChIKey | FAGLIJCTTFUJIG-HNNXBMFYSA-N |
| XLogP | 2.05 |
| TPSA | 94.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-[[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]acetyl]-[(1S)-1-phenylpropyl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]acetyl]-[(1S)-1-phenylpropyl]amino]acetate?
The IUPAC name of methyl 2-[[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]acetyl]-[(1S)-1-phenylpropyl]amino]acetate (CID 97096397) is methyl 2-[[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]acetyl]-[(1S)-1-phenylpropyl]amino]acetate.
What is the SMILES notation for methyl 2-[[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]acetyl]-[(1S)-1-phenylpropyl]amino]acetate?
The canonical SMILES for methyl 2-[[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]acetyl]-[(1S)-1-phenylpropyl]amino]acetate is CC[C@@H](c1ccccc1)N(CC(=O)OC)C(=O)COCc1nc(C)no1.
What is the InChIKey of methyl 2-[[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]acetyl]-[(1S)-1-phenylpropyl]amino]acetate?
The InChIKey is FAGLIJCTTFUJIG-HNNXBMFYSA-N. The full InChI is InChI=1S/C18H23N3O5/c1-4-15(14-8-6-5-7-9-14)21(10-18(23)24-3)17(22)12-25-11-16-19-13(2)20-26-16/h5-9,15H,4,10-12H2,1-3H3/t15-/m0/s1.
What are the key properties of methyl 2-[[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]acetyl]-[(1S)-1-phenylpropyl]amino]acetate?
methyl 2-[[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]acetyl]-[(1S)-1-phenylpropyl]amino]acetate has a molecular weight of 361.40 g/mol, XLogP of 2.05, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]acetyl]-[(1S)-1-phenylpropyl]amino]acetate is sourced from PubChem (CID 97096397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).