C15H25N3 — CID 97096725
cis-(1S,3R)-3-ethyl-N-[[(8S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl]methyl]cyclopentan-1-amine (PubChem CID 97096725) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is cis-(1S,3R)-3-ethyl-N-[[(8S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl]methyl]cyclopentan-1-amine.
| Compound Name | cis-(1S,3R)-3-ethyl-N-[[(8S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl]methyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 97096725 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | cis-(1S,3R)-3-ethyl-N-[[(8S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl]methyl]cyclopentan-1-amine |
| SMILES | CC[C@@H]1CC[C@H](NC[C@@H]2CCCn3ccnc32)C1 |
| InChI | InChI=1S/C15H25N3/c1-2-12-5-6-14(10-12)17-11-13-4-3-8-18-9-7-16-15(13)18/h7,9,12-14,17H,2-6,8,10-11H2,1H3/t12-,13+,14+/m1/s1 |
| InChIKey | FQWBUBDKNHTEOY-RDBSUJKOSA-N |
| XLogP | 2.93 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |