About 5-pyridin-3-yl-N-[(1S)-1-(2H-tetrazol-5-yl)butyl]-1,2-oxazole-3-carboxamide
5-pyridin-3-yl-N-[(1S)-1-(2H-tetrazol-5-yl)butyl]-1,2-oxazole-3-carboxamide (PubChem CID 97098020) has the molecular formula C14H15N7O2
and a molecular weight of 313.32 g/mol. Its IUPAC name is 5-pyridin-3-yl-N-[(1S)-1-(2H-tetrazol-5-yl)butyl]-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-pyridin-3-yl-N-[(1S)-1-(2H-tetrazol-5-yl)butyl]-1,2-oxazole-3-carboxamide |
| PubChem CID | 97098020 |
| Molecular Formula | C14H15N7O2 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 5-pyridin-3-yl-N-[(1S)-1-(2H-tetrazol-5-yl)butyl]-1,2-oxazole-3-carboxamide |
| SMILES | CCC[C@H](NC(=O)c1cc(-c2cccnc2)on1)c1nn[nH]n1 |
| InChI | InChI=1S/C14H15N7O2/c1-2-4-10(13-17-20-21-18-13)16-14(22)11-7-12(23-19-11)9-5-3-6-15-8-9/h3,5-8,10H,2,4H2,1H3,(H,16,22)(H,17,18,20,21)/t10-/m0/s1 |
| InChIKey | OCKQYVAXEVCLHU-JTQLQIEISA-N |
| XLogP | 1.52 |
| TPSA | 122.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-pyridin-3-yl-N-[(1S)-1-(2H-tetrazol-5-yl)butyl]-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyridin-3-yl-N-[(1S)-1-(2H-tetrazol-5-yl)butyl]-1,2-oxazole-3-carboxamide?
The IUPAC name of 5-pyridin-3-yl-N-[(1S)-1-(2H-tetrazol-5-yl)butyl]-1,2-oxazole-3-carboxamide (CID 97098020) is 5-pyridin-3-yl-N-[(1S)-1-(2H-tetrazol-5-yl)butyl]-1,2-oxazole-3-carboxamide.
What is the SMILES notation for 5-pyridin-3-yl-N-[(1S)-1-(2H-tetrazol-5-yl)butyl]-1,2-oxazole-3-carboxamide?
The canonical SMILES for 5-pyridin-3-yl-N-[(1S)-1-(2H-tetrazol-5-yl)butyl]-1,2-oxazole-3-carboxamide is CCC[C@H](NC(=O)c1cc(-c2cccnc2)on1)c1nn[nH]n1.
What is the InChIKey of 5-pyridin-3-yl-N-[(1S)-1-(2H-tetrazol-5-yl)butyl]-1,2-oxazole-3-carboxamide?
The InChIKey is OCKQYVAXEVCLHU-JTQLQIEISA-N. The full InChI is InChI=1S/C14H15N7O2/c1-2-4-10(13-17-20-21-18-13)16-14(22)11-7-12(23-19-11)9-5-3-6-15-8-9/h3,5-8,10H,2,4H2,1H3,(H,16,22)(H,17,18,20,21)/t10-/m0/s1.
What are the key properties of 5-pyridin-3-yl-N-[(1S)-1-(2H-tetrazol-5-yl)butyl]-1,2-oxazole-3-carboxamide?
5-pyridin-3-yl-N-[(1S)-1-(2H-tetrazol-5-yl)butyl]-1,2-oxazole-3-carboxamide has a molecular weight of 313.32 g/mol, XLogP of 1.52, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyridin-3-yl-N-[(1S)-1-(2H-tetrazol-5-yl)butyl]-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 97098020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).