C15H28N4O4S — CID 97098226
[1-[(2R)-2-(1,1-dioxo-1,2-thiazolidin-2-yl)hexanoyl]piperidin-4-yl]urea (PubChem CID 97098226) has the molecular formula C15H28N4O4S and a molecular weight of 360.48 g/mol. Its IUPAC name is [1-[(2R)-2-(1,1-dioxo-1,2-thiazolidin-2-yl)hexanoyl]piperidin-4-yl]urea.
| Compound Name | [1-[(2R)-2-(1,1-dioxo-1,2-thiazolidin-2-yl)hexanoyl]piperidin-4-yl]urea |
|---|---|
| PubChem CID | 97098226 |
| Molecular Formula | C15H28N4O4S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | [1-[(2R)-2-(1,1-dioxo-1,2-thiazolidin-2-yl)hexanoyl]piperidin-4-yl]urea |
| SMILES | CCCC[C@H](C(=O)N1CCC(NC(N)=O)CC1)N1CCCS1(=O)=O |
| InChI | InChI=1S/C15H28N4O4S/c1-2-3-5-13(19-8-4-11-24(19,22)23)14(20)18-9-6-12(7-10-18)17-15(16)21/h12-13H,2-11H2,1H3,(H3,16,17,21)/t13-/m1/s1 |
| InChIKey | IHIJANXZFDPIIC-CYBMUJFWSA-N |
| XLogP | 0.24 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |