C18H20F2N2O — CID 97099961
4-[[[(1S)-1-(2,5-difluorophenyl)ethyl]amino]methyl]-N-ethylbenzamide (PubChem CID 97099961) has the molecular formula C18H20F2N2O and a molecular weight of 318.37 g/mol. Its IUPAC name is 4-[[[(1S)-1-(2,5-difluorophenyl)ethyl]amino]methyl]-N-ethylbenzamide.
| Compound Name | 4-[[[(1S)-1-(2,5-difluorophenyl)ethyl]amino]methyl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 97099961 |
| Molecular Formula | C18H20F2N2O |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 4-[[[(1S)-1-(2,5-difluorophenyl)ethyl]amino]methyl]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1ccc(CN[C@@H](C)c2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C18H20F2N2O/c1-3-21-18(23)14-6-4-13(5-7-14)11-22-12(2)16-10-15(19)8-9-17(16)20/h4-10,12,22H,3,11H2,1-2H3,(H,21,23)/t12-/m0/s1 |
| InChIKey | QXNXDXFAKOJSDA-LBPRGKRZSA-N |
| XLogP | 3.57 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |