About ethyl 4-[[(1R,2S)-2-(3-cyanophenyl)cyclopropanecarbonyl]amino]-1H-pyrrole-2-carboxylate
ethyl 4-[[(1R,2S)-2-(3-cyanophenyl)cyclopropanecarbonyl]amino]-1H-pyrrole-2-carboxylate (PubChem CID 97100274) has the molecular formula C18H17N3O3
and a molecular weight of 323.35 g/mol. Its IUPAC name is ethyl 4-[[(1R,2S)-2-(3-cyanophenyl)cyclopropanecarbonyl]amino]-1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[[(1R,2S)-2-(3-cyanophenyl)cyclopropanecarbonyl]amino]-1H-pyrrole-2-carboxylate |
| PubChem CID | 97100274 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | ethyl 4-[[(1R,2S)-2-(3-cyanophenyl)cyclopropanecarbonyl]amino]-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1cc(NC(=O)[C@@H]2C[C@@H]2c2cccc(C#N)c2)c[nH]1 |
| InChI | InChI=1S/C18H17N3O3/c1-2-24-18(23)16-7-13(10-20-16)21-17(22)15-8-14(15)12-5-3-4-11(6-12)9-19/h3-7,10,14-15,20H,2,8H2,1H3,(H,21,22)/t14-,15-/m1/s1 |
| InChIKey | QUVBXXAJBNVAAJ-HUUCEWRRSA-N |
| XLogP | 2.81 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-[[(1R,2S)-2-(3-cyanophenyl)cyclopropanecarbonyl]amino]-1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[[(1R,2S)-2-(3-cyanophenyl)cyclopropanecarbonyl]amino]-1H-pyrrole-2-carboxylate?
The IUPAC name of ethyl 4-[[(1R,2S)-2-(3-cyanophenyl)cyclopropanecarbonyl]amino]-1H-pyrrole-2-carboxylate (CID 97100274) is ethyl 4-[[(1R,2S)-2-(3-cyanophenyl)cyclopropanecarbonyl]amino]-1H-pyrrole-2-carboxylate.
What is the SMILES notation for ethyl 4-[[(1R,2S)-2-(3-cyanophenyl)cyclopropanecarbonyl]amino]-1H-pyrrole-2-carboxylate?
The canonical SMILES for ethyl 4-[[(1R,2S)-2-(3-cyanophenyl)cyclopropanecarbonyl]amino]-1H-pyrrole-2-carboxylate is CCOC(=O)c1cc(NC(=O)[C@@H]2C[C@@H]2c2cccc(C#N)c2)c[nH]1.
What is the InChIKey of ethyl 4-[[(1R,2S)-2-(3-cyanophenyl)cyclopropanecarbonyl]amino]-1H-pyrrole-2-carboxylate?
The InChIKey is QUVBXXAJBNVAAJ-HUUCEWRRSA-N. The full InChI is InChI=1S/C18H17N3O3/c1-2-24-18(23)16-7-13(10-20-16)21-17(22)15-8-14(15)12-5-3-4-11(6-12)9-19/h3-7,10,14-15,20H,2,8H2,1H3,(H,21,22)/t14-,15-/m1/s1.
What are the key properties of ethyl 4-[[(1R,2S)-2-(3-cyanophenyl)cyclopropanecarbonyl]amino]-1H-pyrrole-2-carboxylate?
ethyl 4-[[(1R,2S)-2-(3-cyanophenyl)cyclopropanecarbonyl]amino]-1H-pyrrole-2-carboxylate has a molecular weight of 323.35 g/mol, XLogP of 2.81, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[[(1R,2S)-2-(3-cyanophenyl)cyclopropanecarbonyl]amino]-1H-pyrrole-2-carboxylate is sourced from PubChem (CID 97100274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).