About (2R)-N'-(4-ethoxybenzoyl)-1-(oxan-4-yl)pyrrolidine-2-carbohydrazide
(2R)-N'-(4-ethoxybenzoyl)-1-(oxan-4-yl)pyrrolidine-2-carbohydrazide (PubChem CID 97101186) has the molecular formula C19H27N3O4
and a molecular weight of 361.44 g/mol. Its IUPAC name is (2R)-N'-(4-ethoxybenzoyl)-1-(oxan-4-yl)pyrrolidine-2-carbohydrazide.
Molecular Properties
| Compound Name | (2R)-N'-(4-ethoxybenzoyl)-1-(oxan-4-yl)pyrrolidine-2-carbohydrazide |
| PubChem CID | 97101186 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | (2R)-N'-(4-ethoxybenzoyl)-1-(oxan-4-yl)pyrrolidine-2-carbohydrazide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)[C@H]2CCCN2C2CCOCC2)cc1 |
| InChI | InChI=1S/C19H27N3O4/c1-2-26-16-7-5-14(6-8-16)18(23)20-21-19(24)17-4-3-11-22(17)15-9-12-25-13-10-15/h5-8,15,17H,2-4,9-13H2,1H3,(H,20,23)(H,21,24)/t17-/m1/s1 |
| InChIKey | BPZSYMNSEYHNBC-QGZVFWFLSA-N |
| XLogP | 1.49 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-N'-(4-ethoxybenzoyl)-1-(oxan-4-yl)pyrrolidine-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N'-(4-ethoxybenzoyl)-1-(oxan-4-yl)pyrrolidine-2-carbohydrazide?
The IUPAC name of (2R)-N'-(4-ethoxybenzoyl)-1-(oxan-4-yl)pyrrolidine-2-carbohydrazide (CID 97101186) is (2R)-N'-(4-ethoxybenzoyl)-1-(oxan-4-yl)pyrrolidine-2-carbohydrazide.
What is the SMILES notation for (2R)-N'-(4-ethoxybenzoyl)-1-(oxan-4-yl)pyrrolidine-2-carbohydrazide?
The canonical SMILES for (2R)-N'-(4-ethoxybenzoyl)-1-(oxan-4-yl)pyrrolidine-2-carbohydrazide is CCOc1ccc(C(=O)NNC(=O)[C@H]2CCCN2C2CCOCC2)cc1.
What is the InChIKey of (2R)-N'-(4-ethoxybenzoyl)-1-(oxan-4-yl)pyrrolidine-2-carbohydrazide?
The InChIKey is BPZSYMNSEYHNBC-QGZVFWFLSA-N. The full InChI is InChI=1S/C19H27N3O4/c1-2-26-16-7-5-14(6-8-16)18(23)20-21-19(24)17-4-3-11-22(17)15-9-12-25-13-10-15/h5-8,15,17H,2-4,9-13H2,1H3,(H,20,23)(H,21,24)/t17-/m1/s1.
What are the key properties of (2R)-N'-(4-ethoxybenzoyl)-1-(oxan-4-yl)pyrrolidine-2-carbohydrazide?
(2R)-N'-(4-ethoxybenzoyl)-1-(oxan-4-yl)pyrrolidine-2-carbohydrazide has a molecular weight of 361.44 g/mol, XLogP of 1.49, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N'-(4-ethoxybenzoyl)-1-(oxan-4-yl)pyrrolidine-2-carbohydrazide is sourced from PubChem (CID 97101186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).